C17H28N2O3S — CID 124727571
(1S,4S)-1-[[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]sulfonylmethyl]-7,7-dimethylbicyclo[2.2.1]heptan-2-one (PubChem CID 124727571) has the molecular formula C17H28N2O3S and a molecular weight of 340.49 g/mol. Its IUPAC name is (1S,4S)-1-[[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]sulfonylmethyl]-7,7-dimethylbicyclo[2.2.1]heptan-2-one.
| Compound Name | (1S,4S)-1-[[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]sulfonylmethyl]-7,7-dimethylbicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 124727571 |
| Molecular Formula | C17H28N2O3S |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | (1S,4S)-1-[[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]sulfonylmethyl]-7,7-dimethylbicyclo[2.2.1]heptan-2-one |
| SMILES | CC1(C)[C@H]2CC[C@@]1(CS(=O)(=O)N1CCN3CCC[C@H]3C1)C(=O)C2 |
| InChI | InChI=1S/C17H28N2O3S/c1-16(2)13-5-6-17(16,15(20)10-13)12-23(21,22)19-9-8-18-7-3-4-14(18)11-19/h13-14H,3-12H2,1-2H3/t13-,14-,17+/m0/s1 |
| InChIKey | DASHMJJBDMSNRE-GRDNDAEWSA-N |
| XLogP | 1.49 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |