C16H17F6NO6 — CID 124727827
N-[(2S,3S,4S,5R,6R)-2-[3,5-bis(trifluoromethyl)phenoxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide (PubChem CID 124727827) has the molecular formula C16H17F6NO6 and a molecular weight of 433.30 g/mol. Its IUPAC name is N-[(2S,3S,4S,5R,6R)-2-[3,5-bis(trifluoromethyl)phenoxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide.
| Compound Name | N-[(2S,3S,4S,5R,6R)-2-[3,5-bis(trifluoromethyl)phenoxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 124727827 |
| Molecular Formula | C16H17F6NO6 |
| Molecular Weight | 433.30 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | N-[(2S,3S,4S,5R,6R)-2-[3,5-bis(trifluoromethyl)phenoxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
| SMILES | CC(=O)N[C@@H]1[C@H](Oc2cc(C(F)(F)F)cc(C(F)(F)F)c2)O[C@H](CO)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C16H17F6NO6/c1-6(25)23-11-13(27)12(26)10(5-24)29-14(11)28-9-3-7(15(17,18)19)2-8(4-9)16(20,21)22/h2-4,10-14,24,26-27H,5H2,1H3,(H,23,25)/t10-,11+,12+,13+,14-/m1/s1 |
| InChIKey | SMWDBPKQNHBCGZ-IKOXMDCHSA-N |
| XLogP | 1.05 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.30 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |