C15H22N2OS — CID 124728518
(2S)-2,4-dimethyl-1-[4-(1,3-thiazol-2-yl)piperidin-1-yl]pent-4-en-1-one (PubChem CID 124728518) has the molecular formula C15H22N2OS and a molecular weight of 278.42 g/mol. Its IUPAC name is (2S)-2,4-dimethyl-1-[4-(1,3-thiazol-2-yl)piperidin-1-yl]pent-4-en-1-one.
| Compound Name | (2S)-2,4-dimethyl-1-[4-(1,3-thiazol-2-yl)piperidin-1-yl]pent-4-en-1-one |
|---|---|
| PubChem CID | 124728518 |
| Molecular Formula | C15H22N2OS |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | (2S)-2,4-dimethyl-1-[4-(1,3-thiazol-2-yl)piperidin-1-yl]pent-4-en-1-one |
| SMILES | C=C(C)C[C@H](C)C(=O)N1CCC(c2nccs2)CC1 |
| InChI | InChI=1S/C15H22N2OS/c1-11(2)10-12(3)15(18)17-7-4-13(5-8-17)14-16-6-9-19-14/h6,9,12-13H,1,4-5,7-8,10H2,2-3H3/t12-/m0/s1 |
| InChIKey | DQQFFGBPNQDEKF-LBPRGKRZSA-N |
| XLogP | 3.45 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|