C20H19N7O2 — CID 124729451
(3S,4S)-4-methyl-N-[3-(1,3-oxazol-5-yl)phenyl]-1-([1,2,4]triazolo[4,3-a]pyrazin-8-yl)pyrrolidine-3-carboxamide (PubChem CID 124729451) has the molecular formula C20H19N7O2 and a molecular weight of 389.42 g/mol. Its IUPAC name is (3S,4S)-4-methyl-N-[3-(1,3-oxazol-5-yl)phenyl]-1-([1,2,4]triazolo[4,3-a]pyrazin-8-yl)pyrrolidine-3-carboxamide.
| Compound Name | (3S,4S)-4-methyl-N-[3-(1,3-oxazol-5-yl)phenyl]-1-([1,2,4]triazolo[4,3-a]pyrazin-8-yl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 124729451 |
| Molecular Formula | C20H19N7O2 |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | (3S,4S)-4-methyl-N-[3-(1,3-oxazol-5-yl)phenyl]-1-([1,2,4]triazolo[4,3-a]pyrazin-8-yl)pyrrolidine-3-carboxamide |
| SMILES | C[C@@H]1CN(c2nccn3cnnc23)C[C@H]1C(=O)Nc1cccc(-c2cnco2)c1 |
| InChI | InChI=1S/C20H19N7O2/c1-13-9-27(18-19-25-23-11-26(19)6-5-22-18)10-16(13)20(28)24-15-4-2-3-14(7-15)17-8-21-12-29-17/h2-8,11-13,16H,9-10H2,1H3,(H,24,28)/t13-,16-/m1/s1 |
| InChIKey | GCZFTVJYWITBAK-CZUORRHYSA-N |
| XLogP | 2.49 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |