About 3-(5-methoxy-2,3-dihydro-1H-inden-4-yl)-1-methyl-1-[[(3S)-oxan-3-yl]methyl]urea
3-(5-methoxy-2,3-dihydro-1H-inden-4-yl)-1-methyl-1-[[(3S)-oxan-3-yl]methyl]urea (PubChem CID 124729741) has the molecular formula C18H26N2O3
and a molecular weight of 318.42 g/mol. Its IUPAC name is 3-(5-methoxy-2,3-dihydro-1H-inden-4-yl)-1-methyl-1-[[(3S)-oxan-3-yl]methyl]urea.
Molecular Properties
| Compound Name | 3-(5-methoxy-2,3-dihydro-1H-inden-4-yl)-1-methyl-1-[[(3S)-oxan-3-yl]methyl]urea |
| PubChem CID | 124729741 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | 3-(5-methoxy-2,3-dihydro-1H-inden-4-yl)-1-methyl-1-[[(3S)-oxan-3-yl]methyl]urea |
| SMILES | COc1ccc2c(c1NC(=O)N(C)C[C@@H]1CCCOC1)CCC2 |
| InChI | InChI=1S/C18H26N2O3/c1-20(11-13-5-4-10-23-12-13)18(21)19-17-15-7-3-6-14(15)8-9-16(17)22-2/h8-9,13H,3-7,10-12H2,1-2H3,(H,19,21)/t13-/m0/s1 |
| InChIKey | GPYMGZHRFXWYAW-ZDUSSCGKSA-N |
| XLogP | 3.07 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(5-methoxy-2,3-dihydro-1H-inden-4-yl)-1-methyl-1-[[(3S)-oxan-3-yl]methyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-methoxy-2,3-dihydro-1H-inden-4-yl)-1-methyl-1-[[(3S)-oxan-3-yl]methyl]urea?
The IUPAC name of 3-(5-methoxy-2,3-dihydro-1H-inden-4-yl)-1-methyl-1-[[(3S)-oxan-3-yl]methyl]urea (CID 124729741) is 3-(5-methoxy-2,3-dihydro-1H-inden-4-yl)-1-methyl-1-[[(3S)-oxan-3-yl]methyl]urea.
What is the SMILES notation for 3-(5-methoxy-2,3-dihydro-1H-inden-4-yl)-1-methyl-1-[[(3S)-oxan-3-yl]methyl]urea?
The canonical SMILES for 3-(5-methoxy-2,3-dihydro-1H-inden-4-yl)-1-methyl-1-[[(3S)-oxan-3-yl]methyl]urea is COc1ccc2c(c1NC(=O)N(C)C[C@@H]1CCCOC1)CCC2.
What is the InChIKey of 3-(5-methoxy-2,3-dihydro-1H-inden-4-yl)-1-methyl-1-[[(3S)-oxan-3-yl]methyl]urea?
The InChIKey is GPYMGZHRFXWYAW-ZDUSSCGKSA-N. The full InChI is InChI=1S/C18H26N2O3/c1-20(11-13-5-4-10-23-12-13)18(21)19-17-15-7-3-6-14(15)8-9-16(17)22-2/h8-9,13H,3-7,10-12H2,1-2H3,(H,19,21)/t13-/m0/s1.
What are the key properties of 3-(5-methoxy-2,3-dihydro-1H-inden-4-yl)-1-methyl-1-[[(3S)-oxan-3-yl]methyl]urea?
3-(5-methoxy-2,3-dihydro-1H-inden-4-yl)-1-methyl-1-[[(3S)-oxan-3-yl]methyl]urea has a molecular weight of 318.42 g/mol, XLogP of 3.07, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-methoxy-2,3-dihydro-1H-inden-4-yl)-1-methyl-1-[[(3S)-oxan-3-yl]methyl]urea is sourced from PubChem (CID 124729741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).