C14H24N2O2 — CID 124729941
N,N'-dimethyl-N,N'-bis[(3S)-oxolan-3-yl]but-2-yne-1,4-diamine (PubChem CID 124729941) has the molecular formula C14H24N2O2 and a molecular weight of 252.36 g/mol. Its IUPAC name is N,N'-dimethyl-N,N'-bis[(3S)-oxolan-3-yl]but-2-yne-1,4-diamine.
| Compound Name | N,N'-dimethyl-N,N'-bis[(3S)-oxolan-3-yl]but-2-yne-1,4-diamine |
|---|---|
| PubChem CID | 124729941 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | N,N'-dimethyl-N,N'-bis[(3S)-oxolan-3-yl]but-2-yne-1,4-diamine |
| SMILES | CN(CC#CCN(C)[C@H]1CCOC1)[C@H]1CCOC1 |
| InChI | InChI=1S/C14H24N2O2/c1-15(13-5-9-17-11-13)7-3-4-8-16(2)14-6-10-18-12-14/h13-14H,5-12H2,1-2H3/t13-,14-/m0/s1 |
| InChIKey | GUYPDAQYHQFPHL-KBPBESRZSA-N |
| XLogP | 0.43 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|