About 1H-pyrrole-2-carboxylic acid
1H-pyrrole-2-carboxylic acid (PubChem CID 12473) has the molecular formula C5H5NO2
and a molecular weight of 111.10 g/mol. Its IUPAC name is 1H-pyrrole-2-carboxylic acid.
Molecular Properties
| Compound Name | 1H-pyrrole-2-carboxylic acid |
| PubChem CID | 12473 |
| Molecular Formula | C5H5NO2 |
| Molecular Weight | 111.10 g/mol |
| Exact Mass | 111.03 |
| IUPAC Name | 1H-pyrrole-2-carboxylic acid |
| SMILES | O=C(O)c1ccc[nH]1 |
| InChI | InChI=1S/C5H5NO2/c7-5(8)4-2-1-3-6-4/h1-3,6H,(H,7,8) |
| InChIKey | WRHZVMBBRYBTKZ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.10 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1H-pyrrole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrrole-2-carboxylic acid?
The IUPAC name of 1H-pyrrole-2-carboxylic acid (CID 12473) is 1H-pyrrole-2-carboxylic acid.
What is the SMILES notation for 1H-pyrrole-2-carboxylic acid?
The canonical SMILES for 1H-pyrrole-2-carboxylic acid is O=C(O)c1ccc[nH]1.
What is the InChIKey of 1H-pyrrole-2-carboxylic acid?
The InChIKey is WRHZVMBBRYBTKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5NO2/c7-5(8)4-2-1-3-6-4/h1-3,6H,(H,7,8).
What are the key properties of 1H-pyrrole-2-carboxylic acid?
1H-pyrrole-2-carboxylic acid has a molecular weight of 111.10 g/mol, XLogP of 0.71, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrrole-2-carboxylic acid is sourced from PubChem (CID 12473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).