C14H25NO4 — CID 124730673
(2R)-1-[(4aS,8aS)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-6-yl]-2-(2-methoxyethoxy)propan-1-one (PubChem CID 124730673) has the molecular formula C14H25NO4 and a molecular weight of 271.36 g/mol. Its IUPAC name is (2R)-1-[(4aS,8aS)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-6-yl]-2-(2-methoxyethoxy)propan-1-one.
| Compound Name | (2R)-1-[(4aS,8aS)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-6-yl]-2-(2-methoxyethoxy)propan-1-one |
|---|---|
| PubChem CID | 124730673 |
| Molecular Formula | C14H25NO4 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | (2R)-1-[(4aS,8aS)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-6-yl]-2-(2-methoxyethoxy)propan-1-one |
| SMILES | COCCO[C@H](C)C(=O)N1CC[C@@H]2OCCC[C@H]2C1 |
| InChI | InChI=1S/C14H25NO4/c1-11(18-9-8-17-2)14(16)15-6-5-13-12(10-15)4-3-7-19-13/h11-13H,3-10H2,1-2H3/t11-,12+,13+/m1/s1 |
| InChIKey | HURWXXNARSEGHZ-AGIUHOORSA-N |
| XLogP | 1.07 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|