C20H40N4 — CID 124731738
(2R,5S)-1-ethyl-4-[(E)-4-[(2S,5S)-4-ethyl-2,5-dimethylpiperazin-1-yl]but-2-enyl]-2,5-dimethylpiperazine (PubChem CID 124731738) has the molecular formula C20H40N4 and a molecular weight of 336.57 g/mol. Its IUPAC name is (2R,5S)-1-ethyl-4-[(E)-4-[(2S,5S)-4-ethyl-2,5-dimethylpiperazin-1-yl]but-2-enyl]-2,5-dimethylpiperazine.
| Compound Name | (2R,5S)-1-ethyl-4-[(E)-4-[(2S,5S)-4-ethyl-2,5-dimethylpiperazin-1-yl]but-2-enyl]-2,5-dimethylpiperazine |
|---|---|
| PubChem CID | 124731738 |
| Molecular Formula | C20H40N4 |
| Molecular Weight | 336.57 g/mol |
| Exact Mass | 336.33 |
| IUPAC Name | (2R,5S)-1-ethyl-4-[(E)-4-[(2S,5S)-4-ethyl-2,5-dimethylpiperazin-1-yl]but-2-enyl]-2,5-dimethylpiperazine |
| SMILES | CCN1C[C@H](C)N(C/C=C/CN2C[C@H](C)N(CC)C[C@@H]2C)C[C@H]1C |
| InChI | InChI=1S/C20H40N4/c1-7-21-13-19(5)23(15-17(21)3)11-9-10-12-24-16-18(4)22(8-2)14-20(24)6/h9-10,17-20H,7-8,11-16H2,1-6H3/b10-9+/t17-,18+,19-,20-/m0/s1 |
| InChIKey | JDRCZTUHLZBKII-ZAWDAWMMSA-N |
| XLogP | 2.37 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.57 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|