C11H11Br3 — CID 124732167
(1R,2S,3S,5S,6S,8R,9R,10R)-1,7,7-tribromopentacyclo[6.3.0.02,6.03,10.05,9]undecane (PubChem CID 124732167) has the molecular formula C11H11Br3 and a molecular weight of 382.92 g/mol. Its IUPAC name is (1R,2S,3S,5S,6S,8R,9R,10R)-1,7,7-tribromopentacyclo[6.3.0.02,6.03,10.05,9]undecane.
| Compound Name | (1R,2S,3S,5S,6S,8R,9R,10R)-1,7,7-tribromopentacyclo[6.3.0.02,6.03,10.05,9]undecane |
|---|---|
| PubChem CID | 124732167 |
| Molecular Formula | C11H11Br3 |
| Molecular Weight | 382.92 g/mol |
| Exact Mass | 379.84 |
| IUPAC Name | (1R,2S,3S,5S,6S,8R,9R,10R)-1,7,7-tribromopentacyclo[6.3.0.02,6.03,10.05,9]undecane |
| SMILES | BrC1(Br)[C@H]2[C@H]3C[C@H]4[C@H]5C[C@@](Br)([C@@H]42)[C@H]1[C@H]53 |
| InChI | InChI=1S/C11H11Br3/c12-10-2-5-3-1-4-6(5)9(10)11(13,14)8(4)7(3)10/h3-9H,1-2H2/t3-,4-,5+,6-,7-,8-,9+,10+/m0/s1 |
| InChIKey | JJUJHPPUQWQEPP-ZBKHOBQRSA-N |
| XLogP | 3.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.92 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|