C13H26N2O2 — CID 124732222
4-ethoxy-1-[(2R,3S)-2,3,4-trimethylpiperazin-1-yl]butan-1-one (PubChem CID 124732222) has the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. Its IUPAC name is 4-ethoxy-1-[(2R,3S)-2,3,4-trimethylpiperazin-1-yl]butan-1-one.
| Compound Name | 4-ethoxy-1-[(2R,3S)-2,3,4-trimethylpiperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 124732222 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 4-ethoxy-1-[(2R,3S)-2,3,4-trimethylpiperazin-1-yl]butan-1-one |
| SMILES | CCOCCCC(=O)N1CCN(C)[C@@H](C)[C@H]1C |
| InChI | InChI=1S/C13H26N2O2/c1-5-17-10-6-7-13(16)15-9-8-14(4)11(2)12(15)3/h11-12H,5-10H2,1-4H3/t11-,12+/m0/s1 |
| InChIKey | JKGLJGFKJNTKNN-NWDGAFQWSA-N |
| XLogP | 1.35 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|