C16H19F2N3O3 — CID 124733091
(8aS)-7-[2-(2,2-difluoroethoxy)ethyl]-2-phenyl-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione (PubChem CID 124733091) has the molecular formula C16H19F2N3O3 and a molecular weight of 339.34 g/mol. Its IUPAC name is (8aS)-7-[2-(2,2-difluoroethoxy)ethyl]-2-phenyl-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione.
| Compound Name | (8aS)-7-[2-(2,2-difluoroethoxy)ethyl]-2-phenyl-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione |
|---|---|
| PubChem CID | 124733091 |
| Molecular Formula | C16H19F2N3O3 |
| Molecular Weight | 339.34 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | (8aS)-7-[2-(2,2-difluoroethoxy)ethyl]-2-phenyl-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione |
| SMILES | O=C1[C@@H]2CN(CCOCC(F)F)CCN2C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C16H19F2N3O3/c17-14(18)11-24-9-8-19-6-7-20-13(10-19)15(22)21(16(20)23)12-4-2-1-3-5-12/h1-5,13-14H,6-11H2/t13-/m0/s1 |
| InChIKey | KFQTXIFRZKOHRN-ZDUSSCGKSA-N |
| XLogP | 1.42 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.34 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|