C21H26N2O4 — CID 124735323
[(1R,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] 3-(2,4-dioxoquinazolin-1-yl)propanoate (PubChem CID 124735323) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is [(1R,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] 3-(2,4-dioxoquinazolin-1-yl)propanoate.
| Compound Name | [(1R,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] 3-(2,4-dioxoquinazolin-1-yl)propanoate |
|---|---|
| PubChem CID | 124735323 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | [(1R,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] 3-(2,4-dioxoquinazolin-1-yl)propanoate |
| SMILES | C[C@H]1[C@H]2C[C@H](C[C@H]1OC(=O)CCn1c(=O)[nH]c(=O)c3ccccc31)C2(C)C |
| InChI | InChI=1S/C21H26N2O4/c1-12-15-10-13(21(15,2)3)11-17(12)27-18(24)8-9-23-16-7-5-4-6-14(16)19(25)22-20(23)26/h4-7,12-13,15,17H,8-11H2,1-3H3,(H,22,25,26)/t12-,13+,15+,17+/m0/s1 |
| InChIKey | NNCQEBGPSQEZIY-TZDHZFECSA-N |
| XLogP | 2.69 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |