About 9-ethyl-6-[(2R)-2-(1,3,5-trimethylpyrazol-4-yl)pyrrolidin-1-yl]purine
9-ethyl-6-[(2R)-2-(1,3,5-trimethylpyrazol-4-yl)pyrrolidin-1-yl]purine (PubChem CID 124735733) has the molecular formula C17H23N7
and a molecular weight of 325.42 g/mol. Its IUPAC name is 9-ethyl-6-[(2R)-2-(1,3,5-trimethylpyrazol-4-yl)pyrrolidin-1-yl]purine.
Molecular Properties
| Compound Name | 9-ethyl-6-[(2R)-2-(1,3,5-trimethylpyrazol-4-yl)pyrrolidin-1-yl]purine |
| PubChem CID | 124735733 |
| Molecular Formula | C17H23N7 |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | 9-ethyl-6-[(2R)-2-(1,3,5-trimethylpyrazol-4-yl)pyrrolidin-1-yl]purine |
| SMILES | CCn1cnc2c(N3CCC[C@@H]3c3c(C)nn(C)c3C)ncnc21 |
| InChI | InChI=1S/C17H23N7/c1-5-23-10-20-15-16(23)18-9-19-17(15)24-8-6-7-13(24)14-11(2)21-22(4)12(14)3/h9-10,13H,5-8H2,1-4H3/t13-/m1/s1 |
| InChIKey | NUZROSDGWKPLLN-CYBMUJFWSA-N |
| XLogP | 2.54 |
| TPSA | 64.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 9-ethyl-6-[(2R)-2-(1,3,5-trimethylpyrazol-4-yl)pyrrolidin-1-yl]purine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-ethyl-6-[(2R)-2-(1,3,5-trimethylpyrazol-4-yl)pyrrolidin-1-yl]purine?
The IUPAC name of 9-ethyl-6-[(2R)-2-(1,3,5-trimethylpyrazol-4-yl)pyrrolidin-1-yl]purine (CID 124735733) is 9-ethyl-6-[(2R)-2-(1,3,5-trimethylpyrazol-4-yl)pyrrolidin-1-yl]purine.
What is the SMILES notation for 9-ethyl-6-[(2R)-2-(1,3,5-trimethylpyrazol-4-yl)pyrrolidin-1-yl]purine?
The canonical SMILES for 9-ethyl-6-[(2R)-2-(1,3,5-trimethylpyrazol-4-yl)pyrrolidin-1-yl]purine is CCn1cnc2c(N3CCC[C@@H]3c3c(C)nn(C)c3C)ncnc21.
What is the InChIKey of 9-ethyl-6-[(2R)-2-(1,3,5-trimethylpyrazol-4-yl)pyrrolidin-1-yl]purine?
The InChIKey is NUZROSDGWKPLLN-CYBMUJFWSA-N. The full InChI is InChI=1S/C17H23N7/c1-5-23-10-20-15-16(23)18-9-19-17(15)24-8-6-7-13(24)14-11(2)21-22(4)12(14)3/h9-10,13H,5-8H2,1-4H3/t13-/m1/s1.
What are the key properties of 9-ethyl-6-[(2R)-2-(1,3,5-trimethylpyrazol-4-yl)pyrrolidin-1-yl]purine?
9-ethyl-6-[(2R)-2-(1,3,5-trimethylpyrazol-4-yl)pyrrolidin-1-yl]purine has a molecular weight of 325.42 g/mol, XLogP of 2.54, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 9-ethyl-6-[(2R)-2-(1,3,5-trimethylpyrazol-4-yl)pyrrolidin-1-yl]purine is sourced from PubChem (CID 124735733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).