C16H30N2O3S — CID 124735745
(2R,6S)-2,6-dimethyl-N-[(1S,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]morpholine-4-sulfonamide (PubChem CID 124735745) has the molecular formula C16H30N2O3S and a molecular weight of 330.49 g/mol. Its IUPAC name is (2R,6S)-2,6-dimethyl-N-[(1S,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]morpholine-4-sulfonamide.
| Compound Name | (2R,6S)-2,6-dimethyl-N-[(1S,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]morpholine-4-sulfonamide |
|---|---|
| PubChem CID | 124735745 |
| Molecular Formula | C16H30N2O3S |
| Molecular Weight | 330.49 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | (2R,6S)-2,6-dimethyl-N-[(1S,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]morpholine-4-sulfonamide |
| SMILES | C[C@@H]1CN(S(=O)(=O)N[C@H]2C[C@H]3CC[C@@]2(C)C3(C)C)C[C@H](C)O1 |
| InChI | InChI=1S/C16H30N2O3S/c1-11-9-18(10-12(2)21-11)22(19,20)17-14-8-13-6-7-16(14,5)15(13,3)4/h11-14,17H,6-10H2,1-5H3/t11-,12+,13-,14+,16-/m1/s1 |
| InChIKey | NVDBIICQNQCZDB-YMSVYLFOSA-N |
| XLogP | 2.14 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.49 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |