About 2-[methyl-[(1R,2R)-2-methylsulfanylcyclopentyl]amino]-N-[(2S)-2-phenylbutyl]acetamide
2-[methyl-[(1R,2R)-2-methylsulfanylcyclopentyl]amino]-N-[(2S)-2-phenylbutyl]acetamide (PubChem CID 124735933) has the molecular formula C19H30N2OS
and a molecular weight of 334.53 g/mol. Its IUPAC name is 2-[methyl-[(1R,2R)-2-methylsulfanylcyclopentyl]amino]-N-[(2S)-2-phenylbutyl]acetamide.
Molecular Properties
| Compound Name | 2-[methyl-[(1R,2R)-2-methylsulfanylcyclopentyl]amino]-N-[(2S)-2-phenylbutyl]acetamide |
| PubChem CID | 124735933 |
| Molecular Formula | C19H30N2OS |
| Molecular Weight | 334.53 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | 2-[methyl-[(1R,2R)-2-methylsulfanylcyclopentyl]amino]-N-[(2S)-2-phenylbutyl]acetamide |
| SMILES | CC[C@H](CNC(=O)CN(C)[C@@H]1CCC[C@H]1SC)c1ccccc1 |
| InChI | InChI=1S/C19H30N2OS/c1-4-15(16-9-6-5-7-10-16)13-20-19(22)14-21(2)17-11-8-12-18(17)23-3/h5-7,9-10,15,17-18H,4,8,11-14H2,1-3H3,(H,20,22)/t15-,17-,18-/m1/s1 |
| InChIKey | OGFANUUYNQTQGY-KBAYOESNSA-N |
| XLogP | 3.51 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.53 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[methyl-[(1R,2R)-2-methylsulfanylcyclopentyl]amino]-N-[(2S)-2-phenylbutyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[methyl-[(1R,2R)-2-methylsulfanylcyclopentyl]amino]-N-[(2S)-2-phenylbutyl]acetamide?
The IUPAC name of 2-[methyl-[(1R,2R)-2-methylsulfanylcyclopentyl]amino]-N-[(2S)-2-phenylbutyl]acetamide (CID 124735933) is 2-[methyl-[(1R,2R)-2-methylsulfanylcyclopentyl]amino]-N-[(2S)-2-phenylbutyl]acetamide.
What is the SMILES notation for 2-[methyl-[(1R,2R)-2-methylsulfanylcyclopentyl]amino]-N-[(2S)-2-phenylbutyl]acetamide?
The canonical SMILES for 2-[methyl-[(1R,2R)-2-methylsulfanylcyclopentyl]amino]-N-[(2S)-2-phenylbutyl]acetamide is CC[C@H](CNC(=O)CN(C)[C@@H]1CCC[C@H]1SC)c1ccccc1.
What is the InChIKey of 2-[methyl-[(1R,2R)-2-methylsulfanylcyclopentyl]amino]-N-[(2S)-2-phenylbutyl]acetamide?
The InChIKey is OGFANUUYNQTQGY-KBAYOESNSA-N. The full InChI is InChI=1S/C19H30N2OS/c1-4-15(16-9-6-5-7-10-16)13-20-19(22)14-21(2)17-11-8-12-18(17)23-3/h5-7,9-10,15,17-18H,4,8,11-14H2,1-3H3,(H,20,22)/t15-,17-,18-/m1/s1.
What are the key properties of 2-[methyl-[(1R,2R)-2-methylsulfanylcyclopentyl]amino]-N-[(2S)-2-phenylbutyl]acetamide?
2-[methyl-[(1R,2R)-2-methylsulfanylcyclopentyl]amino]-N-[(2S)-2-phenylbutyl]acetamide has a molecular weight of 334.53 g/mol, XLogP of 3.51, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[methyl-[(1R,2R)-2-methylsulfanylcyclopentyl]amino]-N-[(2S)-2-phenylbutyl]acetamide is sourced from PubChem (CID 124735933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).