About (1R)-3-[(2R,4R)-2-methyl-4-(2-methylphenyl)pyrrolidin-1-yl]-1-phenylpropan-1-ol
(1R)-3-[(2R,4R)-2-methyl-4-(2-methylphenyl)pyrrolidin-1-yl]-1-phenylpropan-1-ol (PubChem CID 124735982) has the molecular formula C21H27NO
and a molecular weight of 309.45 g/mol. Its IUPAC name is (1R)-3-[(2R,4R)-2-methyl-4-(2-methylphenyl)pyrrolidin-1-yl]-1-phenylpropan-1-ol.
Molecular Properties
| Compound Name | (1R)-3-[(2R,4R)-2-methyl-4-(2-methylphenyl)pyrrolidin-1-yl]-1-phenylpropan-1-ol |
| PubChem CID | 124735982 |
| Molecular Formula | C21H27NO |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | (1R)-3-[(2R,4R)-2-methyl-4-(2-methylphenyl)pyrrolidin-1-yl]-1-phenylpropan-1-ol |
| SMILES | Cc1ccccc1[C@H]1C[C@@H](C)N(CC[C@@H](O)c2ccccc2)C1 |
| InChI | InChI=1S/C21H27NO/c1-16-8-6-7-11-20(16)19-14-17(2)22(15-19)13-12-21(23)18-9-4-3-5-10-18/h3-11,17,19,21,23H,12-15H2,1-2H3/t17-,19+,21-/m1/s1 |
| InChIKey | OGKSXUYCCKUANP-SLYNCCJLSA-N |
| XLogP | 4.30 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1R)-3-[(2R,4R)-2-methyl-4-(2-methylphenyl)pyrrolidin-1-yl]-1-phenylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-3-[(2R,4R)-2-methyl-4-(2-methylphenyl)pyrrolidin-1-yl]-1-phenylpropan-1-ol?
The IUPAC name of (1R)-3-[(2R,4R)-2-methyl-4-(2-methylphenyl)pyrrolidin-1-yl]-1-phenylpropan-1-ol (CID 124735982) is (1R)-3-[(2R,4R)-2-methyl-4-(2-methylphenyl)pyrrolidin-1-yl]-1-phenylpropan-1-ol.
What is the SMILES notation for (1R)-3-[(2R,4R)-2-methyl-4-(2-methylphenyl)pyrrolidin-1-yl]-1-phenylpropan-1-ol?
The canonical SMILES for (1R)-3-[(2R,4R)-2-methyl-4-(2-methylphenyl)pyrrolidin-1-yl]-1-phenylpropan-1-ol is Cc1ccccc1[C@H]1C[C@@H](C)N(CC[C@@H](O)c2ccccc2)C1.
What is the InChIKey of (1R)-3-[(2R,4R)-2-methyl-4-(2-methylphenyl)pyrrolidin-1-yl]-1-phenylpropan-1-ol?
The InChIKey is OGKSXUYCCKUANP-SLYNCCJLSA-N. The full InChI is InChI=1S/C21H27NO/c1-16-8-6-7-11-20(16)19-14-17(2)22(15-19)13-12-21(23)18-9-4-3-5-10-18/h3-11,17,19,21,23H,12-15H2,1-2H3/t17-,19+,21-/m1/s1.
What are the key properties of (1R)-3-[(2R,4R)-2-methyl-4-(2-methylphenyl)pyrrolidin-1-yl]-1-phenylpropan-1-ol?
(1R)-3-[(2R,4R)-2-methyl-4-(2-methylphenyl)pyrrolidin-1-yl]-1-phenylpropan-1-ol has a molecular weight of 309.45 g/mol, XLogP of 4.30, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-3-[(2R,4R)-2-methyl-4-(2-methylphenyl)pyrrolidin-1-yl]-1-phenylpropan-1-ol is sourced from PubChem (CID 124735982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).