C17H13N3O4 — CID 124736524
4-[(1R,2R,6S,7S,8R,12S)-10-methyl-9,11-dioxo-3,13-dioxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-en-5-yl]benzonitrile (PubChem CID 124736524) has the molecular formula C17H13N3O4 and a molecular weight of 323.31 g/mol. Its IUPAC name is 4-[(1R,2R,6S,7S,8R,12S)-10-methyl-9,11-dioxo-3,13-dioxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-en-5-yl]benzonitrile.
| Compound Name | 4-[(1R,2R,6S,7S,8R,12S)-10-methyl-9,11-dioxo-3,13-dioxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-en-5-yl]benzonitrile |
|---|---|
| PubChem CID | 124736524 |
| Molecular Formula | C17H13N3O4 |
| Molecular Weight | 323.31 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 4-[(1R,2R,6S,7S,8R,12S)-10-methyl-9,11-dioxo-3,13-dioxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-en-5-yl]benzonitrile |
| SMILES | CN1C(=O)[C@@H]2[C@H]3O[C@@H]([C@@H]4C(c5ccc(C#N)cc5)=NO[C@@H]34)[C@@H]2C1=O |
| InChI | InChI=1S/C17H13N3O4/c1-20-16(21)9-10(17(20)22)14-15-11(13(9)23-14)12(19-24-15)8-4-2-7(6-18)3-5-8/h2-5,9-11,13-15H,1H3/t9-,10+,11+,13-,14-,15-/m1/s1 |
| InChIKey | OZRAWQDORAFFRG-ADLWPHQSSA-N |
| XLogP | 0.29 |
| TPSA | 91.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.31 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|