C15H24N4 — CID 124736808
(8S)-N-[[(1S,6S)-2,6-dimethylcyclohex-2-en-1-yl]methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine (PubChem CID 124736808) has the molecular formula C15H24N4 and a molecular weight of 260.38 g/mol. Its IUPAC name is (8S)-N-[[(1S,6S)-2,6-dimethylcyclohex-2-en-1-yl]methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine.
| Compound Name | (8S)-N-[[(1S,6S)-2,6-dimethylcyclohex-2-en-1-yl]methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine |
|---|---|
| PubChem CID | 124736808 |
| Molecular Formula | C15H24N4 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | (8S)-N-[[(1S,6S)-2,6-dimethylcyclohex-2-en-1-yl]methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine |
| SMILES | CC1=CCC[C@H](C)[C@@H]1CN[C@H]1CCCn2ncnc21 |
| InChI | InChI=1S/C15H24N4/c1-11-5-3-6-12(2)13(11)9-16-14-7-4-8-19-15(14)17-10-18-19/h5,10,12-14,16H,3-4,6-9H2,1-2H3/t12-,13+,14-/m0/s1 |
| InChIKey | PDMKGYBQJWLPHY-MJBXVCDLSA-N |
| XLogP | 2.69 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|