About N-[(4S)-4-hydroxy-3,4-dihydro-2H-chromen-8-yl]-5-(1H-pyrazol-5-yl)thiophene-2-carboxamide
N-[(4S)-4-hydroxy-3,4-dihydro-2H-chromen-8-yl]-5-(1H-pyrazol-5-yl)thiophene-2-carboxamide (PubChem CID 124736881) has the molecular formula C17H15N3O3S
and a molecular weight of 341.39 g/mol. Its IUPAC name is N-[(4S)-4-hydroxy-3,4-dihydro-2H-chromen-8-yl]-5-(1H-pyrazol-5-yl)thiophene-2-carboxamide.
Molecular Properties
| Compound Name | N-[(4S)-4-hydroxy-3,4-dihydro-2H-chromen-8-yl]-5-(1H-pyrazol-5-yl)thiophene-2-carboxamide |
| PubChem CID | 124736881 |
| Molecular Formula | C17H15N3O3S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | N-[(4S)-4-hydroxy-3,4-dihydro-2H-chromen-8-yl]-5-(1H-pyrazol-5-yl)thiophene-2-carboxamide |
| SMILES | O=C(Nc1cccc2c1OCC[C@@H]2O)c1ccc(-c2ccn[nH]2)s1 |
| InChI | InChI=1S/C17H15N3O3S/c21-13-7-9-23-16-10(13)2-1-3-12(16)19-17(22)15-5-4-14(24-15)11-6-8-18-20-11/h1-6,8,13,21H,7,9H2,(H,18,20)(H,19,22)/t13-/m0/s1 |
| InChIKey | PECHNMYJXSYAPV-ZDUSSCGKSA-N |
| XLogP | 3.21 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(4S)-4-hydroxy-3,4-dihydro-2H-chromen-8-yl]-5-(1H-pyrazol-5-yl)thiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4S)-4-hydroxy-3,4-dihydro-2H-chromen-8-yl]-5-(1H-pyrazol-5-yl)thiophene-2-carboxamide?
The IUPAC name of N-[(4S)-4-hydroxy-3,4-dihydro-2H-chromen-8-yl]-5-(1H-pyrazol-5-yl)thiophene-2-carboxamide (CID 124736881) is N-[(4S)-4-hydroxy-3,4-dihydro-2H-chromen-8-yl]-5-(1H-pyrazol-5-yl)thiophene-2-carboxamide.
What is the SMILES notation for N-[(4S)-4-hydroxy-3,4-dihydro-2H-chromen-8-yl]-5-(1H-pyrazol-5-yl)thiophene-2-carboxamide?
The canonical SMILES for N-[(4S)-4-hydroxy-3,4-dihydro-2H-chromen-8-yl]-5-(1H-pyrazol-5-yl)thiophene-2-carboxamide is O=C(Nc1cccc2c1OCC[C@@H]2O)c1ccc(-c2ccn[nH]2)s1.
What is the InChIKey of N-[(4S)-4-hydroxy-3,4-dihydro-2H-chromen-8-yl]-5-(1H-pyrazol-5-yl)thiophene-2-carboxamide?
The InChIKey is PECHNMYJXSYAPV-ZDUSSCGKSA-N. The full InChI is InChI=1S/C17H15N3O3S/c21-13-7-9-23-16-10(13)2-1-3-12(16)19-17(22)15-5-4-14(24-15)11-6-8-18-20-11/h1-6,8,13,21H,7,9H2,(H,18,20)(H,19,22)/t13-/m0/s1.
What are the key properties of N-[(4S)-4-hydroxy-3,4-dihydro-2H-chromen-8-yl]-5-(1H-pyrazol-5-yl)thiophene-2-carboxamide?
N-[(4S)-4-hydroxy-3,4-dihydro-2H-chromen-8-yl]-5-(1H-pyrazol-5-yl)thiophene-2-carboxamide has a molecular weight of 341.39 g/mol, XLogP of 3.21, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4S)-4-hydroxy-3,4-dihydro-2H-chromen-8-yl]-5-(1H-pyrazol-5-yl)thiophene-2-carboxamide is sourced from PubChem (CID 124736881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).