C18H33N3O — CID 124737020
1-[(2R,4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-3-[(3S)-1-ethylpiperidin-3-yl]urea (PubChem CID 124737020) has the molecular formula C18H33N3O and a molecular weight of 307.48 g/mol. Its IUPAC name is 1-[(2R,4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-3-[(3S)-1-ethylpiperidin-3-yl]urea.
| Compound Name | 1-[(2R,4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-3-[(3S)-1-ethylpiperidin-3-yl]urea |
|---|---|
| PubChem CID | 124737020 |
| Molecular Formula | C18H33N3O |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.26 |
| IUPAC Name | 1-[(2R,4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-3-[(3S)-1-ethylpiperidin-3-yl]urea |
| SMILES | CCN1CCC[C@H](NC(=O)N[C@@H]2CC[C@@H]3CCCC[C@H]3C2)C1 |
| InChI | InChI=1S/C18H33N3O/c1-2-21-11-5-8-17(13-21)20-18(22)19-16-10-9-14-6-3-4-7-15(14)12-16/h14-17H,2-13H2,1H3,(H2,19,20,22)/t14-,15-,16+,17-/m0/s1 |
| InChIKey | PMIRNAAXHVCTAE-NXOAAHMSSA-N |
| XLogP | 3.13 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |