C20H22N4O2 — CID 124737313
N-[(1R,2R,3R)-3-ethoxy-2-methoxycyclobutyl]-2-pyridin-4-ylquinazolin-4-amine (PubChem CID 124737313) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is N-[(1R,2R,3R)-3-ethoxy-2-methoxycyclobutyl]-2-pyridin-4-ylquinazolin-4-amine.
| Compound Name | N-[(1R,2R,3R)-3-ethoxy-2-methoxycyclobutyl]-2-pyridin-4-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 124737313 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | N-[(1R,2R,3R)-3-ethoxy-2-methoxycyclobutyl]-2-pyridin-4-ylquinazolin-4-amine |
| SMILES | CCO[C@@H]1C[C@@H](Nc2nc(-c3ccncc3)nc3ccccc23)[C@H]1OC |
| InChI | InChI=1S/C20H22N4O2/c1-3-26-17-12-16(18(17)25-2)23-20-14-6-4-5-7-15(14)22-19(24-20)13-8-10-21-11-9-13/h4-11,16-18H,3,12H2,1-2H3,(H,22,23,24)/t16-,17-,18-/m1/s1 |
| InChIKey | PQSUQAOSDZUBPW-KZNAEPCWSA-N |
| XLogP | 3.30 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |