C26H32N2O5 — CID 124737826
[(2R)-1-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-1-oxopropan-2-yl] (2R)-2-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-4-methylpentanoate (PubChem CID 124737826) has the molecular formula C26H32N2O5 and a molecular weight of 452.55 g/mol. Its IUPAC name is [(2R)-1-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-1-oxopropan-2-yl] (2R)-2-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-4-methylpentanoate.
| Compound Name | [(2R)-1-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-1-oxopropan-2-yl] (2R)-2-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-4-methylpentanoate |
|---|---|
| PubChem CID | 124737826 |
| Molecular Formula | C26H32N2O5 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | [(2R)-1-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-1-oxopropan-2-yl] (2R)-2-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-4-methylpentanoate |
| SMILES | CC(C)C[C@H](C(=O)O[C@H](C)C(=O)N1c2ccccc2C[C@@H]1C)N1C(=O)[C@@H]2CC=CC[C@H]2C1=O |
| InChI | InChI=1S/C26H32N2O5/c1-15(2)13-22(28-24(30)19-10-6-7-11-20(19)25(28)31)26(32)33-17(4)23(29)27-16(3)14-18-9-5-8-12-21(18)27/h5-9,12,15-17,19-20,22H,10-11,13-14H2,1-4H3/t16-,17+,19+,20+,22+/m0/s1 |
| InChIKey | QIKOYFZJTMBLSG-MAIORPNCSA-N |
| XLogP | 3.26 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|