C19H27ClN2O2S — CID 124738093
N-[(2S)-2-(4-chlorophenoxy)propyl]-1-[(3R)-thiolan-3-yl]piperidine-4-carboxamide (PubChem CID 124738093) has the molecular formula C19H27ClN2O2S and a molecular weight of 382.96 g/mol. Its IUPAC name is N-[(2S)-2-(4-chlorophenoxy)propyl]-1-[(3R)-thiolan-3-yl]piperidine-4-carboxamide.
| Compound Name | N-[(2S)-2-(4-chlorophenoxy)propyl]-1-[(3R)-thiolan-3-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 124738093 |
| Molecular Formula | C19H27ClN2O2S |
| Molecular Weight | 382.96 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | N-[(2S)-2-(4-chlorophenoxy)propyl]-1-[(3R)-thiolan-3-yl]piperidine-4-carboxamide |
| SMILES | C[C@@H](CNC(=O)C1CCN([C@@H]2CCSC2)CC1)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H27ClN2O2S/c1-14(24-18-4-2-16(20)3-5-18)12-21-19(23)15-6-9-22(10-7-15)17-8-11-25-13-17/h2-5,14-15,17H,6-13H2,1H3,(H,21,23)/t14-,17+/m0/s1 |
| InChIKey | QMPYTDVTYIARRR-WMLDXEAASA-N |
| XLogP | 3.44 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.96 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |