C18H23NOS — CID 124739031
[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-[(2S)-2,3-dihydro-1-benzothiophen-2-yl]methanone (PubChem CID 124739031) has the molecular formula C18H23NOS and a molecular weight of 301.45 g/mol. Its IUPAC name is [(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-[(2S)-2,3-dihydro-1-benzothiophen-2-yl]methanone.
| Compound Name | [(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-[(2S)-2,3-dihydro-1-benzothiophen-2-yl]methanone |
|---|---|
| PubChem CID | 124739031 |
| Molecular Formula | C18H23NOS |
| Molecular Weight | 301.45 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | [(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-[(2S)-2,3-dihydro-1-benzothiophen-2-yl]methanone |
| SMILES | O=C([C@@H]1Cc2ccccc2S1)N1CC[C@@H]2CCCC[C@H]2C1 |
| InChI | InChI=1S/C18H23NOS/c20-18(17-11-14-6-3-4-8-16(14)21-17)19-10-9-13-5-1-2-7-15(13)12-19/h3-4,6,8,13,15,17H,1-2,5,7,9-12H2/t13-,15-,17-/m0/s1 |
| InChIKey | RZLYCJDLTRLGTB-QRTARXTBSA-N |
| XLogP | 3.74 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.45 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |