C18H33N3O4S — CID 124739107
N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]-2-[4-[(3S,4S)-4-hydroxy-1,1-dioxothiolan-3-yl]piperazin-1-yl]acetamide (PubChem CID 124739107) has the molecular formula C18H33N3O4S and a molecular weight of 387.55 g/mol. Its IUPAC name is N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]-2-[4-[(3S,4S)-4-hydroxy-1,1-dioxothiolan-3-yl]piperazin-1-yl]acetamide.
| Compound Name | N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]-2-[4-[(3S,4S)-4-hydroxy-1,1-dioxothiolan-3-yl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 124739107 |
| Molecular Formula | C18H33N3O4S |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]-2-[4-[(3S,4S)-4-hydroxy-1,1-dioxothiolan-3-yl]piperazin-1-yl]acetamide |
| SMILES | C[C@H]1[C@H](C)CCC[C@@H]1NC(=O)CN1CCN([C@@H]2CS(=O)(=O)C[C@H]2O)CC1 |
| InChI | InChI=1S/C18H33N3O4S/c1-13-4-3-5-15(14(13)2)19-18(23)10-20-6-8-21(9-7-20)16-11-26(24,25)12-17(16)22/h13-17,22H,3-12H2,1-2H3,(H,19,23)/t13-,14+,15+,16-,17-/m1/s1 |
| InChIKey | SCDBAUNXINTYSQ-DRRXZNNHSA-N |
| XLogP | -0.30 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |