About [(2R,3S)-2-(4-methoxyphenyl)-1-methylpyrrolidin-3-yl]methyl 4-ethoxybutanoate
[(2R,3S)-2-(4-methoxyphenyl)-1-methylpyrrolidin-3-yl]methyl 4-ethoxybutanoate (PubChem CID 124739109) has the molecular formula C19H29NO4
and a molecular weight of 335.44 g/mol. Its IUPAC name is [(2R,3S)-2-(4-methoxyphenyl)-1-methylpyrrolidin-3-yl]methyl 4-ethoxybutanoate.
Molecular Properties
| Compound Name | [(2R,3S)-2-(4-methoxyphenyl)-1-methylpyrrolidin-3-yl]methyl 4-ethoxybutanoate |
| PubChem CID | 124739109 |
| Molecular Formula | C19H29NO4 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | [(2R,3S)-2-(4-methoxyphenyl)-1-methylpyrrolidin-3-yl]methyl 4-ethoxybutanoate |
| SMILES | CCOCCCC(=O)OC[C@H]1CCN(C)[C@H]1c1ccc(OC)cc1 |
| InChI | InChI=1S/C19H29NO4/c1-4-23-13-5-6-18(21)24-14-16-11-12-20(2)19(16)15-7-9-17(22-3)10-8-15/h7-10,16,19H,4-6,11-14H2,1-3H3/t16-,19+/m1/s1 |
| InChIKey | SCDCVKBRHSLNJA-APWZRJJASA-N |
| XLogP | 3.05 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [(2R,3S)-2-(4-methoxyphenyl)-1-methylpyrrolidin-3-yl]methyl 4-ethoxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,3S)-2-(4-methoxyphenyl)-1-methylpyrrolidin-3-yl]methyl 4-ethoxybutanoate?
The IUPAC name of [(2R,3S)-2-(4-methoxyphenyl)-1-methylpyrrolidin-3-yl]methyl 4-ethoxybutanoate (CID 124739109) is [(2R,3S)-2-(4-methoxyphenyl)-1-methylpyrrolidin-3-yl]methyl 4-ethoxybutanoate.
What is the SMILES notation for [(2R,3S)-2-(4-methoxyphenyl)-1-methylpyrrolidin-3-yl]methyl 4-ethoxybutanoate?
The canonical SMILES for [(2R,3S)-2-(4-methoxyphenyl)-1-methylpyrrolidin-3-yl]methyl 4-ethoxybutanoate is CCOCCCC(=O)OC[C@H]1CCN(C)[C@H]1c1ccc(OC)cc1.
What is the InChIKey of [(2R,3S)-2-(4-methoxyphenyl)-1-methylpyrrolidin-3-yl]methyl 4-ethoxybutanoate?
The InChIKey is SCDCVKBRHSLNJA-APWZRJJASA-N. The full InChI is InChI=1S/C19H29NO4/c1-4-23-13-5-6-18(21)24-14-16-11-12-20(2)19(16)15-7-9-17(22-3)10-8-15/h7-10,16,19H,4-6,11-14H2,1-3H3/t16-,19+/m1/s1.
What are the key properties of [(2R,3S)-2-(4-methoxyphenyl)-1-methylpyrrolidin-3-yl]methyl 4-ethoxybutanoate?
[(2R,3S)-2-(4-methoxyphenyl)-1-methylpyrrolidin-3-yl]methyl 4-ethoxybutanoate has a molecular weight of 335.44 g/mol, XLogP of 3.05, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,3S)-2-(4-methoxyphenyl)-1-methylpyrrolidin-3-yl]methyl 4-ethoxybutanoate is sourced from PubChem (CID 124739109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).