C18H20N2O2 — CID 124739375
5-cyclopropyl-N-[(1R,2R)-2-phenylcyclopentyl]-1,2-oxazole-3-carboxamide (PubChem CID 124739375) has the molecular formula C18H20N2O2 and a molecular weight of 296.37 g/mol. Its IUPAC name is 5-cyclopropyl-N-[(1R,2R)-2-phenylcyclopentyl]-1,2-oxazole-3-carboxamide.
| Compound Name | 5-cyclopropyl-N-[(1R,2R)-2-phenylcyclopentyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 124739375 |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 5-cyclopropyl-N-[(1R,2R)-2-phenylcyclopentyl]-1,2-oxazole-3-carboxamide |
| SMILES | O=C(N[C@@H]1CCC[C@@H]1c1ccccc1)c1cc(C2CC2)on1 |
| InChI | InChI=1S/C18H20N2O2/c21-18(16-11-17(22-20-16)13-9-10-13)19-15-8-4-7-14(15)12-5-2-1-3-6-12/h1-3,5-6,11,13-15H,4,7-10H2,(H,19,21)/t14-,15-/m1/s1 |
| InChIKey | SMQITXNPKYOHAY-HUUCEWRRSA-N |
| XLogP | 3.62 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |