C15H19ClFN3O5S2 — CID 124739681
(2-amino-5-chloro-3-fluorophenyl)-[4-[(3R)-1,1-dioxothiolan-3-yl]sulfonylpiperazin-1-yl]methanone (PubChem CID 124739681) has the molecular formula C15H19ClFN3O5S2 and a molecular weight of 439.92 g/mol. Its IUPAC name is (2-amino-5-chloro-3-fluorophenyl)-[4-[(3R)-1,1-dioxothiolan-3-yl]sulfonylpiperazin-1-yl]methanone.
| Compound Name | (2-amino-5-chloro-3-fluorophenyl)-[4-[(3R)-1,1-dioxothiolan-3-yl]sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 124739681 |
| Molecular Formula | C15H19ClFN3O5S2 |
| Molecular Weight | 439.92 g/mol |
| Exact Mass | 439.04 |
| IUPAC Name | (2-amino-5-chloro-3-fluorophenyl)-[4-[(3R)-1,1-dioxothiolan-3-yl]sulfonylpiperazin-1-yl]methanone |
| SMILES | Nc1c(F)cc(Cl)cc1C(=O)N1CCN(S(=O)(=O)[C@@H]2CCS(=O)(=O)C2)CC1 |
| InChI | InChI=1S/C15H19ClFN3O5S2/c16-10-7-12(14(18)13(17)8-10)15(21)19-2-4-20(5-3-19)27(24,25)11-1-6-26(22,23)9-11/h7-8,11H,1-6,9,18H2/t11-/m1/s1 |
| InChIKey | TWJWFBLFIIKZGU-LLVKDONJSA-N |
| XLogP | 0.34 |
| TPSA | 117.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.92 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|