C19H25ClN2O2 — CID 124739967
(3R)-N-[3-(4-chlorophenyl)cyclobutyl]-3-[(3R)-oxolan-3-yl]pyrrolidine-1-carboxamide (PubChem CID 124739967) has the molecular formula C19H25ClN2O2 and a molecular weight of 348.87 g/mol. Its IUPAC name is (3R)-N-[3-(4-chlorophenyl)cyclobutyl]-3-[(3R)-oxolan-3-yl]pyrrolidine-1-carboxamide.
| Compound Name | (3R)-N-[3-(4-chlorophenyl)cyclobutyl]-3-[(3R)-oxolan-3-yl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 124739967 |
| Molecular Formula | C19H25ClN2O2 |
| Molecular Weight | 348.87 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | (3R)-N-[3-(4-chlorophenyl)cyclobutyl]-3-[(3R)-oxolan-3-yl]pyrrolidine-1-carboxamide |
| SMILES | O=C(NC1CC(c2ccc(Cl)cc2)C1)N1CC[C@H]([C@H]2CCOC2)C1 |
| InChI | InChI=1S/C19H25ClN2O2/c20-17-3-1-13(2-4-17)16-9-18(10-16)21-19(23)22-7-5-14(11-22)15-6-8-24-12-15/h1-4,14-16,18H,5-12H2,(H,21,23)/t14-,15-,16?,18?/m0/s1 |
| InChIKey | UESHVMHUPFIZFH-WMTDPASSSA-N |
| XLogP | 3.65 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.87 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |