C16H17FN4O2 — CID 124740123
1-(4-fluorophenyl)-2-[(2S)-1-(3-methyltriazole-4-carbonyl)pyrrolidin-2-yl]ethanone (PubChem CID 124740123) has the molecular formula C16H17FN4O2 and a molecular weight of 316.34 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-2-[(2S)-1-(3-methyltriazole-4-carbonyl)pyrrolidin-2-yl]ethanone.
| Compound Name | 1-(4-fluorophenyl)-2-[(2S)-1-(3-methyltriazole-4-carbonyl)pyrrolidin-2-yl]ethanone |
|---|---|
| PubChem CID | 124740123 |
| Molecular Formula | C16H17FN4O2 |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 1-(4-fluorophenyl)-2-[(2S)-1-(3-methyltriazole-4-carbonyl)pyrrolidin-2-yl]ethanone |
| SMILES | Cn1nncc1C(=O)N1CCC[C@H]1CC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H17FN4O2/c1-20-14(10-18-19-20)16(23)21-8-2-3-13(21)9-15(22)11-4-6-12(17)7-5-11/h4-7,10,13H,2-3,8-9H2,1H3/t13-/m0/s1 |
| InChIKey | UHTVRWSJGGNRMK-ZDUSSCGKSA-N |
| XLogP | 1.83 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |