C16H22N2O4S — CID 124740416
5-(methylsulfamoyl)-N-[(1R,2S,6S,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]furan-2-carboxamide (PubChem CID 124740416) has the molecular formula C16H22N2O4S and a molecular weight of 338.43 g/mol. Its IUPAC name is 5-(methylsulfamoyl)-N-[(1R,2S,6S,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]furan-2-carboxamide.
| Compound Name | 5-(methylsulfamoyl)-N-[(1R,2S,6S,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 124740416 |
| Molecular Formula | C16H22N2O4S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 5-(methylsulfamoyl)-N-[(1R,2S,6S,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]furan-2-carboxamide |
| SMILES | CNS(=O)(=O)c1ccc(C(=O)N[C@@H]2C[C@H]3C[C@H]2[C@H]2CCC[C@@H]32)o1 |
| InChI | InChI=1S/C16H22N2O4S/c1-17-23(20,21)15-6-5-14(22-15)16(19)18-13-8-9-7-12(13)11-4-2-3-10(9)11/h5-6,9-13,17H,2-4,7-8H2,1H3,(H,18,19)/t9-,10+,11+,12+,13-/m1/s1 |
| InChIKey | URULWVFMMHXPFC-QNWJLWSRSA-N |
| XLogP | 1.74 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |