C15H21N3O3S — CID 124741788
(3R)-3-[[(6-methylsulfonylquinazolin-4-yl)amino]methyl]pentan-1-ol (PubChem CID 124741788) has the molecular formula C15H21N3O3S and a molecular weight of 323.42 g/mol. Its IUPAC name is (3R)-3-[[(6-methylsulfonylquinazolin-4-yl)amino]methyl]pentan-1-ol.
| Compound Name | (3R)-3-[[(6-methylsulfonylquinazolin-4-yl)amino]methyl]pentan-1-ol |
|---|---|
| PubChem CID | 124741788 |
| Molecular Formula | C15H21N3O3S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | (3R)-3-[[(6-methylsulfonylquinazolin-4-yl)amino]methyl]pentan-1-ol |
| SMILES | CC[C@H](CCO)CNc1ncnc2ccc(S(C)(=O)=O)cc12 |
| InChI | InChI=1S/C15H21N3O3S/c1-3-11(6-7-19)9-16-15-13-8-12(22(2,20)21)4-5-14(13)17-10-18-15/h4-5,8,10-11,19H,3,6-7,9H2,1-2H3,(H,16,17,18)/t11-/m1/s1 |
| InChIKey | WWXZQSJFNYWZHR-LLVKDONJSA-N |
| XLogP | 1.85 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |