C17H30F3N3O — CID 124742724
N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]-2-[(3S)-3-methyl-4-(2,2,2-trifluoroethyl)piperazin-1-yl]acetamide (PubChem CID 124742724) has the molecular formula C17H30F3N3O and a molecular weight of 349.44 g/mol. Its IUPAC name is N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]-2-[(3S)-3-methyl-4-(2,2,2-trifluoroethyl)piperazin-1-yl]acetamide.
| Compound Name | N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]-2-[(3S)-3-methyl-4-(2,2,2-trifluoroethyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 124742724 |
| Molecular Formula | C17H30F3N3O |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.23 |
| IUPAC Name | N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]-2-[(3S)-3-methyl-4-(2,2,2-trifluoroethyl)piperazin-1-yl]acetamide |
| SMILES | C[C@H]1[C@H](C)CCC[C@@H]1NC(=O)CN1CCN(CC(F)(F)F)[C@@H](C)C1 |
| InChI | InChI=1S/C17H30F3N3O/c1-12-5-4-6-15(14(12)3)21-16(24)10-22-7-8-23(13(2)9-22)11-17(18,19)20/h12-15H,4-11H2,1-3H3,(H,21,24)/t12-,13+,14+,15+/m1/s1 |
| InChIKey | YFBSKUZZDFKFHD-QPSCCSFWSA-N |
| XLogP | 2.50 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |