About 2-[(2S)-1-[(2R)-2-methoxypropyl]sulfonylpiperidin-2-yl]-1,3-thiazole
2-[(2S)-1-[(2R)-2-methoxypropyl]sulfonylpiperidin-2-yl]-1,3-thiazole (PubChem CID 124743874) has the molecular formula C12H20N2O3S2
and a molecular weight of 304.44 g/mol. Its IUPAC name is 2-[(2S)-1-[(2R)-2-methoxypropyl]sulfonylpiperidin-2-yl]-1,3-thiazole.
Molecular Properties
| Compound Name | 2-[(2S)-1-[(2R)-2-methoxypropyl]sulfonylpiperidin-2-yl]-1,3-thiazole |
| PubChem CID | 124743874 |
| Molecular Formula | C12H20N2O3S2 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 2-[(2S)-1-[(2R)-2-methoxypropyl]sulfonylpiperidin-2-yl]-1,3-thiazole |
| SMILES | CO[C@H](C)CS(=O)(=O)N1CCCC[C@H]1c1nccs1 |
| InChI | InChI=1S/C12H20N2O3S2/c1-10(17-2)9-19(15,16)14-7-4-3-5-11(14)12-13-6-8-18-12/h6,8,10-11H,3-5,7,9H2,1-2H3/t10-,11+/m1/s1 |
| InChIKey | ZGATUJAQOSNJNR-MNOVXSKESA-N |
| XLogP | 2.03 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(2S)-1-[(2R)-2-methoxypropyl]sulfonylpiperidin-2-yl]-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2S)-1-[(2R)-2-methoxypropyl]sulfonylpiperidin-2-yl]-1,3-thiazole?
The IUPAC name of 2-[(2S)-1-[(2R)-2-methoxypropyl]sulfonylpiperidin-2-yl]-1,3-thiazole (CID 124743874) is 2-[(2S)-1-[(2R)-2-methoxypropyl]sulfonylpiperidin-2-yl]-1,3-thiazole.
What is the SMILES notation for 2-[(2S)-1-[(2R)-2-methoxypropyl]sulfonylpiperidin-2-yl]-1,3-thiazole?
The canonical SMILES for 2-[(2S)-1-[(2R)-2-methoxypropyl]sulfonylpiperidin-2-yl]-1,3-thiazole is CO[C@H](C)CS(=O)(=O)N1CCCC[C@H]1c1nccs1.
What is the InChIKey of 2-[(2S)-1-[(2R)-2-methoxypropyl]sulfonylpiperidin-2-yl]-1,3-thiazole?
The InChIKey is ZGATUJAQOSNJNR-MNOVXSKESA-N. The full InChI is InChI=1S/C12H20N2O3S2/c1-10(17-2)9-19(15,16)14-7-4-3-5-11(14)12-13-6-8-18-12/h6,8,10-11H,3-5,7,9H2,1-2H3/t10-,11+/m1/s1.
What are the key properties of 2-[(2S)-1-[(2R)-2-methoxypropyl]sulfonylpiperidin-2-yl]-1,3-thiazole?
2-[(2S)-1-[(2R)-2-methoxypropyl]sulfonylpiperidin-2-yl]-1,3-thiazole has a molecular weight of 304.44 g/mol, XLogP of 2.03, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2S)-1-[(2R)-2-methoxypropyl]sulfonylpiperidin-2-yl]-1,3-thiazole is sourced from PubChem (CID 124743874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).