C23H30N2O2 — CID 124744377
2-[(2R)-2-[(1S,2R)-2-hydroxycyclohexyl]piperidin-1-yl]-N-naphthalen-1-ylacetamide (PubChem CID 124744377) has the molecular formula C23H30N2O2 and a molecular weight of 366.50 g/mol. Its IUPAC name is 2-[(2R)-2-[(1S,2R)-2-hydroxycyclohexyl]piperidin-1-yl]-N-naphthalen-1-ylacetamide.
| Compound Name | 2-[(2R)-2-[(1S,2R)-2-hydroxycyclohexyl]piperidin-1-yl]-N-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 124744377 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | 2-[(2R)-2-[(1S,2R)-2-hydroxycyclohexyl]piperidin-1-yl]-N-naphthalen-1-ylacetamide |
| SMILES | O=C(CN1CCCC[C@@H]1[C@@H]1CCCC[C@H]1O)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C23H30N2O2/c26-22-14-4-3-11-19(22)21-13-5-6-15-25(21)16-23(27)24-20-12-7-9-17-8-1-2-10-18(17)20/h1-2,7-10,12,19,21-22,26H,3-6,11,13-16H2,(H,24,27)/t19-,21+,22+/m0/s1 |
| InChIKey | ZXLZDQZQHGJFCD-KSEOMHKRSA-N |
| XLogP | 4.18 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |