C11H16N4O — CID 124746012
2-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-1H-pyrimidin-6-one (PubChem CID 124746012) has the molecular formula C11H16N4O and a molecular weight of 220.28 g/mol. Its IUPAC name is 2-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-1H-pyrimidin-6-one.
| Compound Name | 2-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 124746012 |
| Molecular Formula | C11H16N4O |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 2-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-1H-pyrimidin-6-one |
| SMILES | O=c1ccnc(N2CCN3CCC[C@H]3C2)[nH]1 |
| InChI | InChI=1S/C11H16N4O/c16-10-3-4-12-11(13-10)15-7-6-14-5-1-2-9(14)8-15/h3-4,9H,1-2,5-8H2,(H,12,13,16)/t9-/m0/s1 |
| InChIKey | JMXXAQYGEFKPCR-VIFPVBQESA-N |
| XLogP | 0.05 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |