C20H30N4 — CID 124749899
(2S)-N-[(3-cyclohexylimidazol-4-yl)methyl]-N-methyl-1-(4-methyl-2-pyridinyl)propan-2-amine (PubChem CID 124749899) has the molecular formula C20H30N4 and a molecular weight of 326.49 g/mol. Its IUPAC name is (2S)-N-[(3-cyclohexylimidazol-4-yl)methyl]-N-methyl-1-(4-methyl-2-pyridinyl)propan-2-amine.
| Compound Name | (2S)-N-[(3-cyclohexylimidazol-4-yl)methyl]-N-methyl-1-(4-methyl-2-pyridinyl)propan-2-amine |
|---|---|
| PubChem CID | 124749899 |
| Molecular Formula | C20H30N4 |
| Molecular Weight | 326.49 g/mol |
| Exact Mass | 326.25 |
| IUPAC Name | (2S)-N-[(3-cyclohexylimidazol-4-yl)methyl]-N-methyl-1-(4-methyl-2-pyridinyl)propan-2-amine |
| SMILES | Cc1ccnc(C[C@H](C)N(C)Cc2cncn2C2CCCCC2)c1 |
| InChI | InChI=1S/C20H30N4/c1-16-9-10-22-18(11-16)12-17(2)23(3)14-20-13-21-15-24(20)19-7-5-4-6-8-19/h9-11,13,15,17,19H,4-8,12,14H2,1-3H3/t17-/m0/s1 |
| InChIKey | BSCVSOTYFMZNKM-KRWDZBQOSA-N |
| XLogP | 4.15 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.49 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |