C19H21N3O3 — CID 124750079
3-[[2-[[(S)-cyclopropyl(pyridin-2-yl)methyl]-methylamino]acetyl]amino]benzoic acid (PubChem CID 124750079) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is 3-[[2-[[(S)-cyclopropyl(pyridin-2-yl)methyl]-methylamino]acetyl]amino]benzoic acid.
| Compound Name | 3-[[2-[[(S)-cyclopropyl(pyridin-2-yl)methyl]-methylamino]acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 124750079 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 3-[[2-[[(S)-cyclopropyl(pyridin-2-yl)methyl]-methylamino]acetyl]amino]benzoic acid |
| SMILES | CN(CC(=O)Nc1cccc(C(=O)O)c1)[C@H](c1ccccn1)C1CC1 |
| InChI | InChI=1S/C19H21N3O3/c1-22(18(13-8-9-13)16-7-2-3-10-20-16)12-17(23)21-15-6-4-5-14(11-15)19(24)25/h2-7,10-11,13,18H,8-9,12H2,1H3,(H,21,23)(H,24,25)/t18-/m0/s1 |
| InChIKey | CCKOLTBLCYLHDY-SFHVURJKSA-N |
| XLogP | 2.80 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |