About [(2S)-butan-2-yl] N-(4-bromophenyl)carbamate
[(2S)-butan-2-yl] N-(4-bromophenyl)carbamate (PubChem CID 124750280) has the molecular formula C11H14BrNO2
and a molecular weight of 272.14 g/mol. Its IUPAC name is [(2S)-butan-2-yl] N-(4-bromophenyl)carbamate.
Molecular Properties
| Compound Name | [(2S)-butan-2-yl] N-(4-bromophenyl)carbamate |
| PubChem CID | 124750280 |
| Molecular Formula | C11H14BrNO2 |
| Molecular Weight | 272.14 g/mol |
| Exact Mass | 271.02 |
| IUPAC Name | [(2S)-butan-2-yl] N-(4-bromophenyl)carbamate |
| SMILES | CC[C@H](C)OC(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C11H14BrNO2/c1-3-8(2)15-11(14)13-10-6-4-9(12)5-7-10/h4-8H,3H2,1-2H3,(H,13,14)/t8-/m0/s1 |
| InChIKey | XNMXRHQVDYNHKD-QMMMGPOBSA-N |
| XLogP | 3.80 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.14 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(2S)-butan-2-yl] N-(4-bromophenyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-butan-2-yl] N-(4-bromophenyl)carbamate?
The IUPAC name of [(2S)-butan-2-yl] N-(4-bromophenyl)carbamate (CID 124750280) is [(2S)-butan-2-yl] N-(4-bromophenyl)carbamate.
What is the SMILES notation for [(2S)-butan-2-yl] N-(4-bromophenyl)carbamate?
The canonical SMILES for [(2S)-butan-2-yl] N-(4-bromophenyl)carbamate is CC[C@H](C)OC(=O)Nc1ccc(Br)cc1.
What is the InChIKey of [(2S)-butan-2-yl] N-(4-bromophenyl)carbamate?
The InChIKey is XNMXRHQVDYNHKD-QMMMGPOBSA-N. The full InChI is InChI=1S/C11H14BrNO2/c1-3-8(2)15-11(14)13-10-6-4-9(12)5-7-10/h4-8H,3H2,1-2H3,(H,13,14)/t8-/m0/s1.
What are the key properties of [(2S)-butan-2-yl] N-(4-bromophenyl)carbamate?
[(2S)-butan-2-yl] N-(4-bromophenyl)carbamate has a molecular weight of 272.14 g/mol, XLogP of 3.80, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-butan-2-yl] N-(4-bromophenyl)carbamate is sourced from PubChem (CID 124750280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).