C18H21FN2O2 — CID 124750402
(4R)-4-[(7-fluoro-4-methylquinolin-2-yl)methyl]-1-(2-methoxyethyl)pyrrolidin-2-one (PubChem CID 124750402) has the molecular formula C18H21FN2O2 and a molecular weight of 316.38 g/mol. Its IUPAC name is (4R)-4-[(7-fluoro-4-methylquinolin-2-yl)methyl]-1-(2-methoxyethyl)pyrrolidin-2-one.
| Compound Name | (4R)-4-[(7-fluoro-4-methylquinolin-2-yl)methyl]-1-(2-methoxyethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 124750402 |
| Molecular Formula | C18H21FN2O2 |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | (4R)-4-[(7-fluoro-4-methylquinolin-2-yl)methyl]-1-(2-methoxyethyl)pyrrolidin-2-one |
| SMILES | COCCN1C[C@H](Cc2cc(C)c3ccc(F)cc3n2)CC1=O |
| InChI | InChI=1S/C18H21FN2O2/c1-12-7-15(20-17-10-14(19)3-4-16(12)17)8-13-9-18(22)21(11-13)5-6-23-2/h3-4,7,10,13H,5-6,8-9,11H2,1-2H3/t13-/m1/s1 |
| InChIKey | CSDNCBBZHXRDHW-CYBMUJFWSA-N |
| XLogP | 2.72 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |