About N-[[(1R)-2,2-dimethyl-1-phenylcyclopropyl]methyl]-N-methyl-3-(1H-pyrazol-4-yl)propanamide
N-[[(1R)-2,2-dimethyl-1-phenylcyclopropyl]methyl]-N-methyl-3-(1H-pyrazol-4-yl)propanamide (PubChem CID 124751399) has the molecular formula C19H25N3O
and a molecular weight of 311.43 g/mol. Its IUPAC name is N-[[(1R)-2,2-dimethyl-1-phenylcyclopropyl]methyl]-N-methyl-3-(1H-pyrazol-4-yl)propanamide.
Molecular Properties
| Compound Name | N-[[(1R)-2,2-dimethyl-1-phenylcyclopropyl]methyl]-N-methyl-3-(1H-pyrazol-4-yl)propanamide |
| PubChem CID | 124751399 |
| Molecular Formula | C19H25N3O |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | N-[[(1R)-2,2-dimethyl-1-phenylcyclopropyl]methyl]-N-methyl-3-(1H-pyrazol-4-yl)propanamide |
| SMILES | CN(C[C@]1(c2ccccc2)CC1(C)C)C(=O)CCc1cn[nH]c1 |
| InChI | InChI=1S/C19H25N3O/c1-18(2)13-19(18,16-7-5-4-6-8-16)14-22(3)17(23)10-9-15-11-20-21-12-15/h4-8,11-12H,9-10,13-14H2,1-3H3,(H,20,21)/t19-/m0/s1 |
| InChIKey | GLCGAYMPDHYVRD-IBGZPJMESA-N |
| XLogP | 3.17 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[[(1R)-2,2-dimethyl-1-phenylcyclopropyl]methyl]-N-methyl-3-(1H-pyrazol-4-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(1R)-2,2-dimethyl-1-phenylcyclopropyl]methyl]-N-methyl-3-(1H-pyrazol-4-yl)propanamide?
The IUPAC name of N-[[(1R)-2,2-dimethyl-1-phenylcyclopropyl]methyl]-N-methyl-3-(1H-pyrazol-4-yl)propanamide (CID 124751399) is N-[[(1R)-2,2-dimethyl-1-phenylcyclopropyl]methyl]-N-methyl-3-(1H-pyrazol-4-yl)propanamide.
What is the SMILES notation for N-[[(1R)-2,2-dimethyl-1-phenylcyclopropyl]methyl]-N-methyl-3-(1H-pyrazol-4-yl)propanamide?
The canonical SMILES for N-[[(1R)-2,2-dimethyl-1-phenylcyclopropyl]methyl]-N-methyl-3-(1H-pyrazol-4-yl)propanamide is CN(C[C@]1(c2ccccc2)CC1(C)C)C(=O)CCc1cn[nH]c1.
What is the InChIKey of N-[[(1R)-2,2-dimethyl-1-phenylcyclopropyl]methyl]-N-methyl-3-(1H-pyrazol-4-yl)propanamide?
The InChIKey is GLCGAYMPDHYVRD-IBGZPJMESA-N. The full InChI is InChI=1S/C19H25N3O/c1-18(2)13-19(18,16-7-5-4-6-8-16)14-22(3)17(23)10-9-15-11-20-21-12-15/h4-8,11-12H,9-10,13-14H2,1-3H3,(H,20,21)/t19-/m0/s1.
What are the key properties of N-[[(1R)-2,2-dimethyl-1-phenylcyclopropyl]methyl]-N-methyl-3-(1H-pyrazol-4-yl)propanamide?
N-[[(1R)-2,2-dimethyl-1-phenylcyclopropyl]methyl]-N-methyl-3-(1H-pyrazol-4-yl)propanamide has a molecular weight of 311.43 g/mol, XLogP of 3.17, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(1R)-2,2-dimethyl-1-phenylcyclopropyl]methyl]-N-methyl-3-(1H-pyrazol-4-yl)propanamide is sourced from PubChem (CID 124751399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).