C21H28N2O2 — CID 124751770
(R)-[1-[2-(2,4-dimethylphenoxy)ethyl]piperidin-4-yl]-pyridin-2-ylmethanol (PubChem CID 124751770) has the molecular formula C21H28N2O2 and a molecular weight of 340.47 g/mol. Its IUPAC name is (R)-[1-[2-(2,4-dimethylphenoxy)ethyl]piperidin-4-yl]-pyridin-2-ylmethanol.
| Compound Name | (R)-[1-[2-(2,4-dimethylphenoxy)ethyl]piperidin-4-yl]-pyridin-2-ylmethanol |
|---|---|
| PubChem CID | 124751770 |
| Molecular Formula | C21H28N2O2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | (R)-[1-[2-(2,4-dimethylphenoxy)ethyl]piperidin-4-yl]-pyridin-2-ylmethanol |
| SMILES | Cc1ccc(OCCN2CCC([C@@H](O)c3ccccn3)CC2)c(C)c1 |
| InChI | InChI=1S/C21H28N2O2/c1-16-6-7-20(17(2)15-16)25-14-13-23-11-8-18(9-12-23)21(24)19-5-3-4-10-22-19/h3-7,10,15,18,21,24H,8-9,11-14H2,1-2H3/t21-/m1/s1 |
| InChIKey | HKDSARLCFQKTRT-OAQYLSRUSA-N |
| XLogP | 3.52 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |