C19H27N3O2 — CID 124752306
3-(azepan-1-ylmethyl)-N-[(3S)-2-oxopiperidin-3-yl]benzamide (PubChem CID 124752306) has the molecular formula C19H27N3O2 and a molecular weight of 329.44 g/mol. Its IUPAC name is 3-(azepan-1-ylmethyl)-N-[(3S)-2-oxopiperidin-3-yl]benzamide.
| Compound Name | 3-(azepan-1-ylmethyl)-N-[(3S)-2-oxopiperidin-3-yl]benzamide |
|---|---|
| PubChem CID | 124752306 |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | 3-(azepan-1-ylmethyl)-N-[(3S)-2-oxopiperidin-3-yl]benzamide |
| SMILES | O=C(N[C@H]1CCCNC1=O)c1cccc(CN2CCCCCC2)c1 |
| InChI | InChI=1S/C19H27N3O2/c23-18(21-17-9-6-10-20-19(17)24)16-8-5-7-15(13-16)14-22-11-3-1-2-4-12-22/h5,7-8,13,17H,1-4,6,9-12,14H2,(H,20,24)(H,21,23)/t17-/m0/s1 |
| InChIKey | JFDNYLPAKUWRFI-KRWDZBQOSA-N |
| XLogP | 2.07 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |