C17H22ClN3O — CID 124753499
5-[[(3R)-3-(2-chlorophenyl)pyrrolidin-1-yl]methyl]-1-(2-methoxyethyl)imidazole (PubChem CID 124753499) has the molecular formula C17H22ClN3O and a molecular weight of 319.84 g/mol. Its IUPAC name is 5-[[(3R)-3-(2-chlorophenyl)pyrrolidin-1-yl]methyl]-1-(2-methoxyethyl)imidazole.
| Compound Name | 5-[[(3R)-3-(2-chlorophenyl)pyrrolidin-1-yl]methyl]-1-(2-methoxyethyl)imidazole |
|---|---|
| PubChem CID | 124753499 |
| Molecular Formula | C17H22ClN3O |
| Molecular Weight | 319.84 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 5-[[(3R)-3-(2-chlorophenyl)pyrrolidin-1-yl]methyl]-1-(2-methoxyethyl)imidazole |
| SMILES | COCCn1cncc1CN1CC[C@H](c2ccccc2Cl)C1 |
| InChI | InChI=1S/C17H22ClN3O/c1-22-9-8-21-13-19-10-15(21)12-20-7-6-14(11-20)16-4-2-3-5-17(16)18/h2-5,10,13-14H,6-9,11-12H2,1H3/t14-/m0/s1 |
| InChIKey | MDQHAUADDSRFCE-AWEZNQCLSA-N |
| XLogP | 3.17 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.84 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |