methyl 6-methyl-3,4-dihydro-2H-quinoline-1-carboxylate

C12H15NO2 — CID 1247540

IUPACmethyl 6-methyl-3,4-dihydro-2H-quinoline-1-carboxylate
SMILESCOC(=O)N1CCCc2cc(C)ccc21
InChIInChI=1S/C12H15NO2/c1-9-5-6-11-10(8-9)4-3-7-13(11)12(14)15-2/h5-6,8H,3-4,7H2,1-2H3
InChIKeyLDRFMYWKINHGEQ-UHFFFAOYSA-N
MW205.26 g/mol
LogP2.51
Rot. Bonds

About methyl 6-methyl-3,4-dihydro-2H-quinoline-1-carboxylate

methyl 6-methyl-3,4-dihydro-2H-quinoline-1-carboxylate (PubChem CID 1247540) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is methyl 6-methyl-3,4-dihydro-2H-quinoline-1-carboxylate.

Molecular Properties

Compound Namemethyl 6-methyl-3,4-dihydro-2H-quinoline-1-carboxylate
PubChem CID1247540
Molecular FormulaC12H15NO2
Molecular Weight205.26 g/mol
Exact Mass205.11
IUPAC Namemethyl 6-methyl-3,4-dihydro-2H-quinoline-1-carboxylate
SMILESCOC(=O)N1CCCc2cc(C)ccc21
InChIInChI=1S/C12H15NO2/c1-9-5-6-11-10(8-9)4-3-7-13(11)12(14)15-2/h5-6,8H,3-4,7H2,1-2H3
InChIKeyLDRFMYWKINHGEQ-UHFFFAOYSA-N
XLogP2.51
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500205.26
LogP ≤ 52.51
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze methyl 6-methyl-3,4-dihydro-2H-quinoline-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 6-methyl-3,4-dihydro-2H-quinoline-1-carboxylate?
The IUPAC name of methyl 6-methyl-3,4-dihydro-2H-quinoline-1-carboxylate (CID 1247540) is methyl 6-methyl-3,4-dihydro-2H-quinoline-1-carboxylate.
What is the SMILES notation for methyl 6-methyl-3,4-dihydro-2H-quinoline-1-carboxylate?
The canonical SMILES for methyl 6-methyl-3,4-dihydro-2H-quinoline-1-carboxylate is COC(=O)N1CCCc2cc(C)ccc21.
What is the InChIKey of methyl 6-methyl-3,4-dihydro-2H-quinoline-1-carboxylate?
The InChIKey is LDRFMYWKINHGEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO2/c1-9-5-6-11-10(8-9)4-3-7-13(11)12(14)15-2/h5-6,8H,3-4,7H2,1-2H3.
What are the key properties of methyl 6-methyl-3,4-dihydro-2H-quinoline-1-carboxylate?
methyl 6-methyl-3,4-dihydro-2H-quinoline-1-carboxylate has a molecular weight of 205.26 g/mol, XLogP of 2.51, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-methyl-3,4-dihydro-2H-quinoline-1-carboxylate is sourced from PubChem (CID 1247540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).