About methyl 6-methyl-3,4-dihydro-2H-quinoline-1-carboxylate
methyl 6-methyl-3,4-dihydro-2H-quinoline-1-carboxylate (PubChem CID 1247540) has the molecular formula C12H15NO2
and a molecular weight of 205.26 g/mol. Its IUPAC name is methyl 6-methyl-3,4-dihydro-2H-quinoline-1-carboxylate.
Molecular Properties
| Compound Name | methyl 6-methyl-3,4-dihydro-2H-quinoline-1-carboxylate |
| PubChem CID | 1247540 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | methyl 6-methyl-3,4-dihydro-2H-quinoline-1-carboxylate |
| SMILES | COC(=O)N1CCCc2cc(C)ccc21 |
| InChI | InChI=1S/C12H15NO2/c1-9-5-6-11-10(8-9)4-3-7-13(11)12(14)15-2/h5-6,8H,3-4,7H2,1-2H3 |
| InChIKey | LDRFMYWKINHGEQ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methyl 6-methyl-3,4-dihydro-2H-quinoline-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-methyl-3,4-dihydro-2H-quinoline-1-carboxylate?
The IUPAC name of methyl 6-methyl-3,4-dihydro-2H-quinoline-1-carboxylate (CID 1247540) is methyl 6-methyl-3,4-dihydro-2H-quinoline-1-carboxylate.
What is the SMILES notation for methyl 6-methyl-3,4-dihydro-2H-quinoline-1-carboxylate?
The canonical SMILES for methyl 6-methyl-3,4-dihydro-2H-quinoline-1-carboxylate is COC(=O)N1CCCc2cc(C)ccc21.
What is the InChIKey of methyl 6-methyl-3,4-dihydro-2H-quinoline-1-carboxylate?
The InChIKey is LDRFMYWKINHGEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO2/c1-9-5-6-11-10(8-9)4-3-7-13(11)12(14)15-2/h5-6,8H,3-4,7H2,1-2H3.
What are the key properties of methyl 6-methyl-3,4-dihydro-2H-quinoline-1-carboxylate?
methyl 6-methyl-3,4-dihydro-2H-quinoline-1-carboxylate has a molecular weight of 205.26 g/mol, XLogP of 2.51, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-methyl-3,4-dihydro-2H-quinoline-1-carboxylate is sourced from PubChem (CID 1247540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).