C17H27N5 — CID 124754791
(2R)-1-[(1-ethylpyrazol-3-yl)methyl]-2-[2-(2-methylimidazol-1-yl)ethyl]piperidine (PubChem CID 124754791) has the molecular formula C17H27N5 and a molecular weight of 301.44 g/mol. Its IUPAC name is (2R)-1-[(1-ethylpyrazol-3-yl)methyl]-2-[2-(2-methylimidazol-1-yl)ethyl]piperidine.
| Compound Name | (2R)-1-[(1-ethylpyrazol-3-yl)methyl]-2-[2-(2-methylimidazol-1-yl)ethyl]piperidine |
|---|---|
| PubChem CID | 124754791 |
| Molecular Formula | C17H27N5 |
| Molecular Weight | 301.44 g/mol |
| Exact Mass | 301.23 |
| IUPAC Name | (2R)-1-[(1-ethylpyrazol-3-yl)methyl]-2-[2-(2-methylimidazol-1-yl)ethyl]piperidine |
| SMILES | CCn1ccc(CN2CCCC[C@@H]2CCn2ccnc2C)n1 |
| InChI | InChI=1S/C17H27N5/c1-3-22-12-7-16(19-22)14-21-10-5-4-6-17(21)8-11-20-13-9-18-15(20)2/h7,9,12-13,17H,3-6,8,10-11,14H2,1-2H3/t17-/m1/s1 |
| InChIKey | OYBRMAHNYBDGEV-QGZVFWFLSA-N |
| XLogP | 2.85 |
| TPSA | 38.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.44 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |