C19H26N4O3S — CID 124754979
2-[(2S)-1-[(5-methylfuran-2-yl)methyl]-3-oxopiperazin-2-yl]-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]acetamide (PubChem CID 124754979) has the molecular formula C19H26N4O3S and a molecular weight of 390.51 g/mol. Its IUPAC name is 2-[(2S)-1-[(5-methylfuran-2-yl)methyl]-3-oxopiperazin-2-yl]-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]acetamide.
| Compound Name | 2-[(2S)-1-[(5-methylfuran-2-yl)methyl]-3-oxopiperazin-2-yl]-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]acetamide |
|---|---|
| PubChem CID | 124754979 |
| Molecular Formula | C19H26N4O3S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 2-[(2S)-1-[(5-methylfuran-2-yl)methyl]-3-oxopiperazin-2-yl]-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]acetamide |
| SMILES | Cc1csc(CCCNC(=O)C[C@H]2C(=O)NCCN2Cc2ccc(C)o2)n1 |
| InChI | InChI=1S/C19H26N4O3S/c1-13-12-27-18(22-13)4-3-7-20-17(24)10-16-19(25)21-8-9-23(16)11-15-6-5-14(2)26-15/h5-6,12,16H,3-4,7-11H2,1-2H3,(H,20,24)(H,21,25)/t16-/m0/s1 |
| InChIKey | PIGLXIFJDUWXDK-INIZCTEOSA-N |
| XLogP | 1.79 |
| TPSA | 87.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|