C21H26FN3O — CID 124755302
N-(2-fluorophenyl)-3-[(2S)-2-(2-pyridin-2-ylethyl)piperidin-1-yl]propanamide (PubChem CID 124755302) has the molecular formula C21H26FN3O and a molecular weight of 355.46 g/mol. Its IUPAC name is N-(2-fluorophenyl)-3-[(2S)-2-(2-pyridin-2-ylethyl)piperidin-1-yl]propanamide.
| Compound Name | N-(2-fluorophenyl)-3-[(2S)-2-(2-pyridin-2-ylethyl)piperidin-1-yl]propanamide |
|---|---|
| PubChem CID | 124755302 |
| Molecular Formula | C21H26FN3O |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | N-(2-fluorophenyl)-3-[(2S)-2-(2-pyridin-2-ylethyl)piperidin-1-yl]propanamide |
| SMILES | O=C(CCN1CCCC[C@H]1CCc1ccccn1)Nc1ccccc1F |
| InChI | InChI=1S/C21H26FN3O/c22-19-9-1-2-10-20(19)24-21(26)13-16-25-15-6-4-8-18(25)12-11-17-7-3-5-14-23-17/h1-3,5,7,9-10,14,18H,4,6,8,11-13,15-16H2,(H,24,26)/t18-/m0/s1 |
| InChIKey | QBZBBRBLKRJECY-SFHVURJKSA-N |
| XLogP | 4.04 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |