C18H21NO3 — CID 124756173
(1S,2S,3R,6S,8S,9R,10S)-5-benzyl-6-ethyl-9-hydroxy-7-oxa-5-azatetracyclo[6.3.0.02,6.03,10]undecan-4-one (PubChem CID 124756173) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is (1S,2S,3R,6S,8S,9R,10S)-5-benzyl-6-ethyl-9-hydroxy-7-oxa-5-azatetracyclo[6.3.0.02,6.03,10]undecan-4-one.
| Compound Name | (1S,2S,3R,6S,8S,9R,10S)-5-benzyl-6-ethyl-9-hydroxy-7-oxa-5-azatetracyclo[6.3.0.02,6.03,10]undecan-4-one |
|---|---|
| PubChem CID | 124756173 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | (1S,2S,3R,6S,8S,9R,10S)-5-benzyl-6-ethyl-9-hydroxy-7-oxa-5-azatetracyclo[6.3.0.02,6.03,10]undecan-4-one |
| SMILES | CC[C@]12O[C@@H]3[C@H](O)[C@H]4C[C@H]3[C@H]1[C@@H]4C(=O)N2Cc1ccccc1 |
| InChI | InChI=1S/C18H21NO3/c1-2-18-14-12-8-11(15(20)16(12)22-18)13(14)17(21)19(18)9-10-6-4-3-5-7-10/h3-7,11-16,20H,2,8-9H2,1H3/t11-,12-,13+,14-,15+,16-,18-/m0/s1 |
| InChIKey | SBMJODKIBJOTSH-RKCAFXDWSA-N |
| XLogP | 1.78 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |